Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Boron trichloride, 1M soln. in dichloromethane, stab.
CAS: 10294-34-5 Molecular Formula: BCl3 Molecular Weight (g/mol): 117.16 MDL Number: MFCD00011313 InChI Key: FAQYAMRNWDIXMY-UHFFFAOYSA-N Synonym: boron trichloride,borane, trichloro,boron chloride,trichloroboron,borontrichloride,chlorure de bore french,unii-k748471rag,hsdb 326,boron trichloride un1741 poison gas PubChem CID: 25135 IUPAC Name: trichloroborane SMILES: ClB(Cl)Cl
| PubChem CID | 25135 |
|---|---|
| CAS | 10294-34-5 |
| Molecular Weight (g/mol) | 117.16 |
| MDL Number | MFCD00011313 |
| SMILES | ClB(Cl)Cl |
| Synonym | boron trichloride,borane, trichloro,boron chloride,trichloroboron,borontrichloride,chlorure de bore french,unii-k748471rag,hsdb 326,boron trichloride un1741 poison gas |
| IUPAC Name | trichloroborane |
| InChI Key | FAQYAMRNWDIXMY-UHFFFAOYSA-N |
| Molecular Formula | BCl3 |
Holmium pieces, 99.9% (metals basis excluding Ta)
CAS: 7440-60-0 Molecular Formula: Ho Molecular Weight (g/mol): 164.93 MDL Number: MFCD00011049 InChI Key: KJZYNXUDTRRSPN-UHFFFAOYSA-N Synonym: atom,unii-w1xx32sqn1,w1xx32sqn1,foil,holmio,chips,ingot,pieces,powder,acmc-1c9ym PubChem CID: 23988 ChEBI: CHEBI:49648 IUPAC Name: holmium SMILES: [Ho]
| PubChem CID | 23988 |
|---|---|
| CAS | 7440-60-0 |
| Molecular Weight (g/mol) | 164.93 |
| ChEBI | CHEBI:49648 |
| MDL Number | MFCD00011049 |
| SMILES | [Ho] |
| Synonym | atom,unii-w1xx32sqn1,w1xx32sqn1,foil,holmio,chips,ingot,pieces,powder,acmc-1c9ym |
| IUPAC Name | holmium |
| InChI Key | KJZYNXUDTRRSPN-UHFFFAOYSA-N |
| Molecular Formula | Ho |
| Name Note | 0.5mm (0.02 in.) dia., Hard, Temper: as drawn |
|---|---|
| Form | Wire |
| MDL Number | MFCD02091683 |
| Solubility Information | Insoluble in water |
| Chemical Name or Material | Platinum Iridium wire |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
| Odor | Odorless |
| Weight | ≈0.44g/10cm |
| Avg. Mol. Wt. or Mol. Wt. Range | Pt:Ir; 80:20 wt% |
Trimethylsilanol, 95%
CAS: 1066-40-6 Molecular Formula: C3H9LiOSi Molecular Weight (g/mol): 96.13 MDL Number: MFCD02751657 InChI Key: OXOZHAWWRPCVGL-UHFFFAOYSA-N Synonym: trimethylsilanol,silanol, trimethyl,unii-z4bin3300p,trimethylhydroxysilane,ccris 1320,hydroxy trimethyl silane,silanol, 1,1,1-trimethyl,ksc504m9b,2004-14-0 lithium salt,10519-96-7 potassium salt PubChem CID: 66110 IUPAC Name: hydroxy(trimethyl)silane SMILES: [Li+].C[Si](C)(C)[O-]
| PubChem CID | 66110 |
|---|---|
| CAS | 1066-40-6 |
| Molecular Weight (g/mol) | 96.13 |
| MDL Number | MFCD02751657 |
| SMILES | [Li+].C[Si](C)(C)[O-] |
| Synonym | trimethylsilanol,silanol, trimethyl,unii-z4bin3300p,trimethylhydroxysilane,ccris 1320,hydroxy trimethyl silane,silanol, 1,1,1-trimethyl,ksc504m9b,2004-14-0 lithium salt,10519-96-7 potassium salt |
| IUPAC Name | hydroxy(trimethyl)silane |
| InChI Key | OXOZHAWWRPCVGL-UHFFFAOYSA-N |
| Molecular Formula | C3H9LiOSi |
Allylchlorodimethylsilane, 94%
CAS: 4028-23-3 Molecular Formula: C5H11ClSi Molecular Weight (g/mol): 134.678 MDL Number: MFCD00000506 InChI Key: KMVZWUQHMJAWSY-UHFFFAOYSA-N Synonym: allyldimethylchlorosilane,allylchlorodimethylsilane,silane, chlorodimethyl-2-propenyl,allyl chloro dimethylsilane,allyl-chloro-dimethyl silane,silane, chlorodimethyl-2-propen-1-yl,admcs,allyl chlorodimethylsilane,allylchlorodimethyl silane,acmc-1afr7 PubChem CID: 77646 IUPAC Name: chloro-dimethyl-prop-2-enylsilane SMILES: C[Si](C)(CC=C)Cl
| PubChem CID | 77646 |
|---|---|
| CAS | 4028-23-3 |
| Molecular Weight (g/mol) | 134.678 |
| MDL Number | MFCD00000506 |
| SMILES | C[Si](C)(CC=C)Cl |
| Synonym | allyldimethylchlorosilane,allylchlorodimethylsilane,silane, chlorodimethyl-2-propenyl,allyl chloro dimethylsilane,allyl-chloro-dimethyl silane,silane, chlorodimethyl-2-propen-1-yl,admcs,allyl chlorodimethylsilane,allylchlorodimethyl silane,acmc-1afr7 |
| IUPAC Name | chloro-dimethyl-prop-2-enylsilane |
| InChI Key | KMVZWUQHMJAWSY-UHFFFAOYSA-N |
| Molecular Formula | C5H11ClSi |
4-Trimethylsilyl-3-butyn-2-ol, 97%
CAS: 6999-19-5 Molecular Formula: C7H14OSi Molecular Weight (g/mol): 142.273 MDL Number: MFCD00190213 InChI Key: HJJSDJHRTMFJLP-UHFFFAOYSA-N Synonym: 4-trimethylsilyl-3-butyn-2-ol,4-trimethylsilyl but-3-yn-2-ol,1-trimethylsilylbut-1-yne-3-ol,+/-4-trimethylsilyl-3-butyn-2-ol,acmc-20mpjc,3-butyn-2-ol, 4-trimethylsilyl-, 2s,acmc-1bfey,hjjsdjhrtmfjlp-uhfffaoysa,3-butyn-2-ol,4-trimethylsilyl PubChem CID: 2760828 IUPAC Name: 4-trimethylsilylbut-3-yn-2-ol SMILES: CC(C#C[Si](C)(C)C)O
| PubChem CID | 2760828 |
|---|---|
| CAS | 6999-19-5 |
| Molecular Weight (g/mol) | 142.273 |
| MDL Number | MFCD00190213 |
| SMILES | CC(C#C[Si](C)(C)C)O |
| Synonym | 4-trimethylsilyl-3-butyn-2-ol,4-trimethylsilyl but-3-yn-2-ol,1-trimethylsilylbut-1-yne-3-ol,+/-4-trimethylsilyl-3-butyn-2-ol,acmc-20mpjc,3-butyn-2-ol, 4-trimethylsilyl-, 2s,acmc-1bfey,hjjsdjhrtmfjlp-uhfffaoysa,3-butyn-2-ol,4-trimethylsilyl |
| IUPAC Name | 4-trimethylsilylbut-3-yn-2-ol |
| InChI Key | HJJSDJHRTMFJLP-UHFFFAOYSA-N |
| Molecular Formula | C7H14OSi |
(Triethylsilyl)acetylene, 97%
CAS: 1777-03-3 Molecular Formula: C8H16Si Molecular Weight (g/mol): 140.30 MDL Number: MFCD00075373 InChI Key: FWSPXZXVNVQHIF-UHFFFAOYSA-N Synonym: triethylsilyl acetylene,ethynyltriethylsilane,triethyl ethynyl silane,triethylsilylacetylene,silane, triethylethynyl,triethylsilyl acetylen,triethylsilyl-acetylene,triethyl-ethynyl-silane PubChem CID: 637947 IUPAC Name: triethyl(ethynyl)silane SMILES: CC[Si](CC)(CC)C#C
| PubChem CID | 637947 |
|---|---|
| CAS | 1777-03-3 |
| Molecular Weight (g/mol) | 140.30 |
| MDL Number | MFCD00075373 |
| SMILES | CC[Si](CC)(CC)C#C |
| Synonym | triethylsilyl acetylene,ethynyltriethylsilane,triethyl ethynyl silane,triethylsilylacetylene,silane, triethylethynyl,triethylsilyl acetylen,triethylsilyl-acetylene,triethyl-ethynyl-silane |
| IUPAC Name | triethyl(ethynyl)silane |
| InChI Key | FWSPXZXVNVQHIF-UHFFFAOYSA-N |
| Molecular Formula | C8H16Si |
Copper sputtering target, 76.2mm (3.0 in.) dia. x 6.35mm (0.250 in.) thick, 99.995% (metals basis), Thermo Scientific™
CAS: 7440-50-8 Molecular Formula: Cu Molecular Weight (g/mol): 63.55 MDL Number: MFCD00010965 InChI Key: RYGMFSIKBFXOCR-UHFFFAOYSA-N Synonym: cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer PubChem CID: 23978 ChEBI: CHEBI:30052 IUPAC Name: copper SMILES: [Cu]
| PubChem CID | 23978 |
|---|---|
| CAS | 7440-50-8 |
| Molecular Weight (g/mol) | 63.55 |
| ChEBI | CHEBI:30052 |
| MDL Number | MFCD00010965 |
| SMILES | [Cu] |
| Synonym | cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer |
| IUPAC Name | copper |
| InChI Key | RYGMFSIKBFXOCR-UHFFFAOYSA-N |
| Molecular Formula | Cu |
(3-Mercaptopropyl)trimethoxysilane, 95%
CAS: 4420-74-0 Molecular Formula: C6H16O3SSi Molecular Weight (g/mol): 196.336 MDL Number: MFCD00004901 InChI Key: UUEWCQRISZBELL-UHFFFAOYSA-N Synonym: trimethoxysilylpropanethiol,3-mercaptopropyltrimethoxysilane,3-mercaptopropyl trimethoxysilane,1-propanethiol, 3-trimethoxysilyl,silquest a 189,3-trimethoxysilyl propanethiol,prosil 196,silane a 189,union carbide a-189,sila-ace s 810 PubChem CID: 20473 IUPAC Name: 3-trimethoxysilylpropane-1-thiol SMILES: CO[Si](CCCS)(OC)OC
| PubChem CID | 20473 |
|---|---|
| CAS | 4420-74-0 |
| Molecular Weight (g/mol) | 196.336 |
| MDL Number | MFCD00004901 |
| SMILES | CO[Si](CCCS)(OC)OC |
| Synonym | trimethoxysilylpropanethiol,3-mercaptopropyltrimethoxysilane,3-mercaptopropyl trimethoxysilane,1-propanethiol, 3-trimethoxysilyl,silquest a 189,3-trimethoxysilyl propanethiol,prosil 196,silane a 189,union carbide a-189,sila-ace s 810 |
| IUPAC Name | 3-trimethoxysilylpropane-1-thiol |
| InChI Key | UUEWCQRISZBELL-UHFFFAOYSA-N |
| Molecular Formula | C6H16O3SSi |
Chlorodimethyl(pentafluorophenyl)silane, 96%
CAS: 20082-71-7 Molecular Formula: C8H6ClF5Si Molecular Weight (g/mol): 260.66 MDL Number: MFCD00000500 InChI Key: PQRFRTCWNCVQHI-UHFFFAOYSA-N Synonym: pentafluorophenyldimethylchlorosilane,flophemesyl chloride,chlorodimethylpentafluorophenylsilane,chlorodimethyl perfluorophenyl silane,silane, chlorodimethyl pentafluorophenyl,chlorodimethyl pentafluorophenyl silane,benzene, 1-chlorodimethylsilyl-2,3,4,5,6-pentafluoro,chlorodimethyl 2,3,4,5,6-pentafluorophenyl silane,chloro dimethyl pentafluorophenyl silane,dimethylpentafluorophenylchlorosilane PubChem CID: 88361 IUPAC Name: chloro-dimethyl-(2,3,4,5,6-pentafluorophenyl)silane SMILES: C[Si](C)(Cl)C1=C(F)C(F)=C(F)C(F)=C1F
| PubChem CID | 88361 |
|---|---|
| CAS | 20082-71-7 |
| Molecular Weight (g/mol) | 260.66 |
| MDL Number | MFCD00000500 |
| SMILES | C[Si](C)(Cl)C1=C(F)C(F)=C(F)C(F)=C1F |
| Synonym | pentafluorophenyldimethylchlorosilane,flophemesyl chloride,chlorodimethylpentafluorophenylsilane,chlorodimethyl perfluorophenyl silane,silane, chlorodimethyl pentafluorophenyl,chlorodimethyl pentafluorophenyl silane,benzene, 1-chlorodimethylsilyl-2,3,4,5,6-pentafluoro,chlorodimethyl 2,3,4,5,6-pentafluorophenyl silane,chloro dimethyl pentafluorophenyl silane,dimethylpentafluorophenylchlorosilane |
| IUPAC Name | chloro-dimethyl-(2,3,4,5,6-pentafluorophenyl)silane |
| InChI Key | PQRFRTCWNCVQHI-UHFFFAOYSA-N |
| Molecular Formula | C8H6ClF5Si |
Triethylsilanol, 97%
CAS: 597-52-4 Molecular Formula: C6H16OSi Molecular Weight (g/mol): 132.278 MDL Number: MFCD00042640 InChI Key: WVMSIBFANXCZKT-UHFFFAOYSA-N Synonym: triethylsilanol,silanol, triethyl,hydroxytriethylsilane,silanol, 1,1,1-triethyl,triethyl hydroxy silane,triethyl hydroxy silicon,tesoh,c2h5 3sioh,acmc-1an47 PubChem CID: 69005 IUPAC Name: triethyl(hydroxy)silane SMILES: CC[Si](CC)(CC)O
| PubChem CID | 69005 |
|---|---|
| CAS | 597-52-4 |
| Molecular Weight (g/mol) | 132.278 |
| MDL Number | MFCD00042640 |
| SMILES | CC[Si](CC)(CC)O |
| Synonym | triethylsilanol,silanol, triethyl,hydroxytriethylsilane,silanol, 1,1,1-triethyl,triethyl hydroxy silane,triethyl hydroxy silicon,tesoh,c2h5 3sioh,acmc-1an47 |
| IUPAC Name | triethyl(hydroxy)silane |
| InChI Key | WVMSIBFANXCZKT-UHFFFAOYSA-N |
| Molecular Formula | C6H16OSi |
1,2-Bis(chlorodimethylsilyl)ethane, tech. 90%
CAS: 13528-93-3 Molecular Formula: C6H16Cl2Si2 Molecular Weight (g/mol): 215.26 MDL Number: MFCD00000505 InChI Key: VGQOKOYKFDUPPJ-UHFFFAOYSA-N Synonym: 1,2-bis chlorodimethylsilyl ethane,ethylenebis chlorodimethylsilane,silane, 1,2-ethanediylbis chlorodimethyl,unii-b4ocj0e6j1,1,1,4,4-tetramethyl-1,4-dichlorodisilethylene,chloro 2-chlorodimethylsilyl ethyl dimethylsilane,b4ocj0e6j1,2,5-dichloro-2,5-dimethyl-2,5-disilahexane,1,1,4,4-tetramethyl-1,4-dichloro-disylethylene PubChem CID: 83552 SMILES: C[Si](C)(Cl)CC[Si](C)(C)Cl
| PubChem CID | 83552 |
|---|---|
| CAS | 13528-93-3 |
| Molecular Weight (g/mol) | 215.26 |
| MDL Number | MFCD00000505 |
| SMILES | C[Si](C)(Cl)CC[Si](C)(C)Cl |
| Synonym | 1,2-bis chlorodimethylsilyl ethane,ethylenebis chlorodimethylsilane,silane, 1,2-ethanediylbis chlorodimethyl,unii-b4ocj0e6j1,1,1,4,4-tetramethyl-1,4-dichlorodisilethylene,chloro 2-chlorodimethylsilyl ethyl dimethylsilane,b4ocj0e6j1,2,5-dichloro-2,5-dimethyl-2,5-disilahexane,1,1,4,4-tetramethyl-1,4-dichloro-disylethylene |
| InChI Key | VGQOKOYKFDUPPJ-UHFFFAOYSA-N |
| Molecular Formula | C6H16Cl2Si2 |
Dimethoxymethyl(3,3,3-trifluoropropyl)silane, 97%
CAS: 358-67-8 Molecular Formula: C6H13F3O2Si Molecular Weight (g/mol): 202.248 MDL Number: MFCD00053175 InChI Key: DIJRHOZMLZRNLM-UHFFFAOYSA-N Synonym: dimethoxy methyl 3,3,3-trifluoropropyl silane,3,3,3-trifluoropropyl methyldimethoxysilane,3,3,3-trifluoropropylmethyldimethoxysilane,dimethoxymethyl 3,3,3-trifluoropropyl silane,silane, dimethoxymethyl 3,3,3-trifluoropropyl,dimethoxy-methyl-3,3,3-trifluoropropyl silane,acmc-1cm60,3,3,3-trifluoropropyldimethoxy methyl silane,methyl 3,3,3-trifluoropropyl dimethoxysilane,silane,dimethoxymethyl 3,3,3-trifluoropropyl PubChem CID: 67751 IUPAC Name: dimethoxy-methyl-(3,3,3-trifluoropropyl)silane SMILES: CO[Si](C)(CCC(F)(F)F)OC
| PubChem CID | 67751 |
|---|---|
| CAS | 358-67-8 |
| Molecular Weight (g/mol) | 202.248 |
| MDL Number | MFCD00053175 |
| SMILES | CO[Si](C)(CCC(F)(F)F)OC |
| Synonym | dimethoxy methyl 3,3,3-trifluoropropyl silane,3,3,3-trifluoropropyl methyldimethoxysilane,3,3,3-trifluoropropylmethyldimethoxysilane,dimethoxymethyl 3,3,3-trifluoropropyl silane,silane, dimethoxymethyl 3,3,3-trifluoropropyl,dimethoxy-methyl-3,3,3-trifluoropropyl silane,acmc-1cm60,3,3,3-trifluoropropyldimethoxy methyl silane,methyl 3,3,3-trifluoropropyl dimethoxysilane,silane,dimethoxymethyl 3,3,3-trifluoropropyl |
| IUPAC Name | dimethoxy-methyl-(3,3,3-trifluoropropyl)silane |
| InChI Key | DIJRHOZMLZRNLM-UHFFFAOYSA-N |
| Molecular Formula | C6H13F3O2Si |
3-(2-Aminoethylamino)propyltrimethoxysilane, 96%
CAS: 1760-24-3 Molecular Formula: C8H22N2O3Si Molecular Weight (g/mol): 222.36 MDL Number: MFCD00008173 InChI Key: PHQOGHDTIVQXHL-UHFFFAOYSA-N Synonym: n-3-trimethoxysilyl propyl ethylenediamine,n-2-aminoethyl-3-aminopropyltrimethoxysilane,3-2-aminoethylamino propyltrimethoxysilane,en-aptas,silicone a-1120,prosil 3128,aas-m,n1-3-trimethoxysilyl propyl ethane-1,2-diamine,unii-28zcs5ga8g,3-2-aminoethyl aminopropyl trimethoxysilane PubChem CID: 15659 IUPAC Name: N'-(3-trimethoxysilylpropyl)ethane-1,2-diamine SMILES: CO[Si](CCCNCCN)(OC)OC
| PubChem CID | 15659 |
|---|---|
| CAS | 1760-24-3 |
| Molecular Weight (g/mol) | 222.36 |
| MDL Number | MFCD00008173 |
| SMILES | CO[Si](CCCNCCN)(OC)OC |
| Synonym | n-3-trimethoxysilyl propyl ethylenediamine,n-2-aminoethyl-3-aminopropyltrimethoxysilane,3-2-aminoethylamino propyltrimethoxysilane,en-aptas,silicone a-1120,prosil 3128,aas-m,n1-3-trimethoxysilyl propyl ethane-1,2-diamine,unii-28zcs5ga8g,3-2-aminoethyl aminopropyl trimethoxysilane |
| IUPAC Name | N'-(3-trimethoxysilylpropyl)ethane-1,2-diamine |
| InChI Key | PHQOGHDTIVQXHL-UHFFFAOYSA-N |
| Molecular Formula | C8H22N2O3Si |
Dimethylsilyldiethylamine, 95%
CAS: 13686-66-3 Molecular Formula: C6H16NSi Molecular Weight (g/mol): 130.29 MDL Number: MFCD00048523 InChI Key: ADTGAVILDBXARD-UHFFFAOYSA-N Synonym: dimethylsilyldiethylamine,n,n-diethyl-1,1-dimethylsilylamine,diethylamino dimethylsilyl,silanamine, n,n-diethyl-1,1-dimethyl,silanamine,n,n-diethyl-1,1-dimethyl,diethylamino dimethyl silicon,diethylaminodimethylsilane,n,n-diethyl-1,1-dimethylsilanamine PubChem CID: 6335300 IUPAC Name: (diethylamino)dimethylsilyl SMILES: CCN(CC)[Si](C)C
| PubChem CID | 6335300 |
|---|---|
| CAS | 13686-66-3 |
| Molecular Weight (g/mol) | 130.29 |
| MDL Number | MFCD00048523 |
| SMILES | CCN(CC)[Si](C)C |
| Synonym | dimethylsilyldiethylamine,n,n-diethyl-1,1-dimethylsilylamine,diethylamino dimethylsilyl,silanamine, n,n-diethyl-1,1-dimethyl,silanamine,n,n-diethyl-1,1-dimethyl,diethylamino dimethyl silicon,diethylaminodimethylsilane,n,n-diethyl-1,1-dimethylsilanamine |
| IUPAC Name | (diethylamino)dimethylsilyl |
| InChI Key | ADTGAVILDBXARD-UHFFFAOYSA-N |
| Molecular Formula | C6H16NSi |